About 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid
2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid (PubChem CID 68536515) has the molecular formula C16H26N2O4S
and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid |
| PubChem CID | 68536515 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid |
| SMILES | C[C@H](Nc1cccs1)C(=O)O.NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C9H17NO2.C7H9NO2S/c10-7-9(6-8(11)12)4-2-1-3-5-9;1-5(7(9)10)8-6-3-2-4-11-6/h1-7,10H2,(H,11,12);2-5,8H,1H3,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | BYVCSPQDDKTUHL-ZSCHJXSPSA-N |
| XLogP | 3.00 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid?
The IUPAC name of 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid (CID 68536515) is 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid.
What is the SMILES notation for 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid?
The canonical SMILES for 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid is C[C@H](Nc1cccs1)C(=O)O.NCC1(CC(=O)O)CCCCC1.
What is the InChIKey of 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid?
The InChIKey is BYVCSPQDDKTUHL-ZSCHJXSPSA-N. The full InChI is InChI=1S/C9H17NO2.C7H9NO2S/c10-7-9(6-8(11)12)4-2-1-3-5-9;1-5(7(9)10)8-6-3-2-4-11-6/h1-7,10H2,(H,11,12);2-5,8H,1H3,(H,9,10)/t;5-/m.0/s1.
What are the key properties of 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid?
2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid has a molecular weight of 342.46 g/mol, XLogP of 3.00, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(aminomethyl)cyclohexyl]acetic acid;(2S)-2-(thiophen-2-ylamino)propanoic acid is sourced from PubChem (CID 68536515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).