About 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol
6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol (PubChem CID 68536661) has the molecular formula C20H17F3O2
and a molecular weight of 346.35 g/mol. Its IUPAC name is 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol.
Molecular Properties
| Compound Name | 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol |
| PubChem CID | 68536661 |
| Molecular Formula | C20H17F3O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol |
| SMILES | COc1ccc2c(O)c(-c3ccccc3)c(CCC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C20H17F3O2/c1-25-16-7-8-17-15(12-16)11-14(9-10-20(21,22)23)18(19(17)24)13-5-3-2-4-6-13/h2-8,11-12,24H,9-10H2,1H3 |
| InChIKey | DNUARDYZVJWFTP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol?
The IUPAC name of 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol (CID 68536661) is 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol.
What is the SMILES notation for 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol?
The canonical SMILES for 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol is COc1ccc2c(O)c(-c3ccccc3)c(CCC(F)(F)F)cc2c1.
What is the InChIKey of 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol?
The InChIKey is DNUARDYZVJWFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3O2/c1-25-16-7-8-17-15(12-16)11-14(9-10-20(21,22)23)18(19(17)24)13-5-3-2-4-6-13/h2-8,11-12,24H,9-10H2,1H3.
What are the key properties of 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol?
6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol has a molecular weight of 346.35 g/mol, XLogP of 5.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-phenyl-3-(3,3,3-trifluoropropyl)naphthalen-1-ol is sourced from PubChem (CID 68536661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).