C34H38F4N6O5 — CID 68537086
(2R)-2-[[3-[4-[[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]amino]-6-methylindazol-1-yl]benzoyl]amino]pentanediamide (PubChem CID 68537086) has the molecular formula C34H38F4N6O5 and a molecular weight of 686.71 g/mol. Its IUPAC name is (2R)-2-[[3-[4-[[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]amino]-6-methylindazol-1-yl]benzoyl]amino]pentanediamide.
| Compound Name | (2R)-2-[[3-[4-[[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]amino]-6-methylindazol-1-yl]benzoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 68537086 |
| Molecular Formula | C34H38F4N6O5 |
| Molecular Weight | 686.71 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | (2R)-2-[[3-[4-[[4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]amino]-6-methylindazol-1-yl]benzoyl]amino]pentanediamide |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(CNc1cc(C)cc2c1cnn2-c1cccc(C(=O)N[C@H](CCC(N)=O)C(N)=O)c1)C(F)(F)F |
| InChI | InChI=1S/C34H38F4N6O5/c1-19-12-26(41-18-33(48,34(36,37)38)17-32(2,3)24-15-21(35)8-10-28(24)49-4)23-16-42-44(27(23)13-19)22-7-5-6-20(14-22)31(47)43-25(30(40)46)9-11-29(39)45/h5-8,10,12-16,25,41,48H,9,11,17-18H2,1-4H3,(H2,39,45)(H2,40,46)(H,43,47)/t25-,33?/m1/s1 |
| InChIKey | SHPUJNHPAOBSGE-NHYGQJMQSA-N |
| XLogP | 4.40 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |