C25H41F3O3Si — CID 68537197
4a-methyl-3-(2,2,2-trifluoroacetyl)-5-[3-tri(propan-2-yl)silyloxypropyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 68537197) has the molecular formula C25H41F3O3Si and a molecular weight of 474.68 g/mol. Its IUPAC name is 4a-methyl-3-(2,2,2-trifluoroacetyl)-5-[3-tri(propan-2-yl)silyloxypropyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 4a-methyl-3-(2,2,2-trifluoroacetyl)-5-[3-tri(propan-2-yl)silyloxypropyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 68537197 |
| Molecular Formula | C25H41F3O3Si |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 4a-methyl-3-(2,2,2-trifluoroacetyl)-5-[3-tri(propan-2-yl)silyloxypropyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC(C)[Si](OCCCC1CCCC2=CC(=O)C(C(=O)C(F)(F)F)CC21C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H41F3O3Si/c1-16(2)32(17(3)4,18(5)6)31-13-9-12-19-10-8-11-20-14-22(29)21(15-24(19,20)7)23(30)25(26,27)28/h14,16-19,21H,8-13,15H2,1-7H3 |
| InChIKey | KUSZIEAEXKBQKQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|