C34H38Cl2N2O6 — CID 68537302
bis(2,4-dimethylpentan-3-yl) 1,4-bis(4-chlorophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (PubChem CID 68537302) has the molecular formula C34H38Cl2N2O6 and a molecular weight of 641.59 g/mol. Its IUPAC name is bis(2,4-dimethylpentan-3-yl) 1,4-bis(4-chlorophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate.
| Compound Name | bis(2,4-dimethylpentan-3-yl) 1,4-bis(4-chlorophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 68537302 |
| Molecular Formula | C34H38Cl2N2O6 |
| Molecular Weight | 641.59 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | bis(2,4-dimethylpentan-3-yl) 1,4-bis(4-chlorophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| SMILES | CC(C)C(OC(=O)N1C(=O)C2=C(c3ccc(Cl)cc3)N(C(=O)OC(C(C)C)C(C)C)C(=O)C2=C1c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C34H38Cl2N2O6/c1-17(2)29(18(3)4)43-33(41)37-27(21-9-13-23(35)14-10-21)25-26(31(37)39)28(22-11-15-24(36)16-12-22)38(32(25)40)34(42)44-30(19(5)6)20(7)8/h9-20,29-30H,1-8H3 |
| InChIKey | UQWDBVCGQVMWAW-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.59 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|