C27H36FNOSi — CID 68537333
[(3aS,4S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,3,3a,4,7,7a-hexahydroisoindol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 68537333) has the molecular formula C27H36FNOSi and a molecular weight of 437.68 g/mol. Its IUPAC name is [(3aS,4S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,3,3a,4,7,7a-hexahydroisoindol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,3,3a,4,7,7a-hexahydroisoindol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 68537333 |
| Molecular Formula | C27H36FNOSi |
| Molecular Weight | 437.68 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | [(3aS,4S,7aS)-2-benzyl-4-(4-fluorophenyl)-1,3,3a,4,7,7a-hexahydroisoindol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC[C@@H]2CN(Cc3ccccc3)C[C@@H]2[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H36FNOSi/c1-27(2,3)31(4,5)30-25-16-13-22-18-29(17-20-9-7-6-8-10-20)19-24(22)26(25)21-11-14-23(28)15-12-21/h6-12,14-16,22,24,26H,13,17-19H2,1-5H3/t22-,24+,26-/m1/s1 |
| InChIKey | IALYVZNKCVXDLR-KTIWRFAQSA-N |
| XLogP | 6.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|