About (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione
(6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione (PubChem CID 685374) has the molecular formula C8H16N2OS
and a molecular weight of 188.30 g/mol. Its IUPAC name is (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione.
Molecular Properties
| Compound Name | (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione |
| PubChem CID | 685374 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione |
| SMILES | CCO[C@@H]1CC(C)(C)NC(=S)N1 |
| InChI | InChI=1S/C8H16N2OS/c1-4-11-6-5-8(2,3)10-7(12)9-6/h6H,4-5H2,1-3H3,(H2,9,10,12)/t6-/m1/s1 |
| InChIKey | NCDREDVLIOGYER-ZCFIWIBFSA-N |
| XLogP | 1.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione?
The IUPAC name of (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione (CID 685374) is (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione.
What is the SMILES notation for (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione?
The canonical SMILES for (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione is CCO[C@@H]1CC(C)(C)NC(=S)N1.
What is the InChIKey of (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione?
The InChIKey is NCDREDVLIOGYER-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H16N2OS/c1-4-11-6-5-8(2,3)10-7(12)9-6/h6H,4-5H2,1-3H3,(H2,9,10,12)/t6-/m1/s1.
What are the key properties of (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione?
(6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione has a molecular weight of 188.30 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-ethoxy-4,4-dimethyl-1,3-diazinane-2-thione is sourced from PubChem (CID 685374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).