C27H32FNO3Si — CID 68537556
(3aR,4S,7aS)-2-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 68537556) has the molecular formula C27H32FNO3Si and a molecular weight of 465.64 g/mol. Its IUPAC name is (3aR,4S,7aS)-2-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4S,7aS)-2-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 68537556 |
| Molecular Formula | C27H32FNO3Si |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (3aR,4S,7aS)-2-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]2[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H32FNO3Si/c1-27(2,3)33(4,5)32-22-16-15-21-24(23(22)19-11-13-20(28)14-12-19)26(31)29(25(21)30)17-18-9-7-6-8-10-18/h6-14,16,21,23-24H,15,17H2,1-5H3/t21-,23-,24-/m0/s1 |
| InChIKey | UCSDYBJOXFMWMV-XWGVYQGASA-N |
| XLogP | 6.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|