C28H22O6 — CID 68537642
(3E)-2-(2,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)methylidene]-1,2-dihydroindene-4,6-diol (PubChem CID 68537642) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is (3E)-2-(2,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)methylidene]-1,2-dihydroindene-4,6-diol.
| Compound Name | (3E)-2-(2,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)methylidene]-1,2-dihydroindene-4,6-diol |
|---|---|
| PubChem CID | 68537642 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (3E)-2-(2,5-dihydroxyphenyl)-1-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)methylidene]-1,2-dihydroindene-4,6-diol |
| SMILES | Oc1ccc(/C=C2/c3c(O)cc(O)cc3C(c3ccc(O)cc3)C2c2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C28H22O6/c29-17-5-1-15(2-6-17)11-22-27-23(13-20(32)14-25(27)34)26(16-3-7-18(30)8-4-16)28(22)21-12-19(31)9-10-24(21)33/h1-14,26,28-34H/b22-11- |
| InChIKey | RQMRXXNARPCUFU-JJFYIABZSA-N |
| XLogP | 5.39 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|