C22H18N2O3S — CID 68537769
2-[3-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]phenyl]sulfanylpyridine-4-carbonitrile (PubChem CID 68537769) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[3-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]phenyl]sulfanylpyridine-4-carbonitrile.
| Compound Name | 2-[3-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]phenyl]sulfanylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 68537769 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[3-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]phenyl]sulfanylpyridine-4-carbonitrile |
| SMILES | CC(=O)c1ccc(OCc2cccc(Sc3cc(C#N)ccn3)c2)c(C)c1O |
| InChI | InChI=1S/C22H18N2O3S/c1-14-20(7-6-19(15(2)25)22(14)26)27-13-17-4-3-5-18(10-17)28-21-11-16(12-23)8-9-24-21/h3-11,26H,13H2,1-2H3 |
| InChIKey | AXHXXHNUXPHDIL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |