About (6E,8Z,10E)-12H-triazino[1,2-a]diazonine
(6E,8Z,10E)-12H-triazino[1,2-a]diazonine (PubChem CID 68538399) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is (6E,8Z,10E)-12H-triazino[1,2-a]diazonine.
Molecular Properties
| Compound Name | (6E,8Z,10E)-12H-triazino[1,2-a]diazonine |
| PubChem CID | 68538399 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (6E,8Z,10E)-12H-triazino[1,2-a]diazonine |
| SMILES | C1=CN2/C=C/C=C\C=C\CN2N=C1 |
| InChI | InChI=1S/C10H11N3/c1-2-4-8-12-9-6-7-11-13(12)10-5-3-1/h1-9H,10H2/b2-1-,5-3+,8-4+ |
| InChIKey | SOHJFPNWVLUIIC-BSIJAEHYSA-N |
| XLogP | 1.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6E,8Z,10E)-12H-triazino[1,2-a]diazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E,8Z,10E)-12H-triazino[1,2-a]diazonine?
The IUPAC name of (6E,8Z,10E)-12H-triazino[1,2-a]diazonine (CID 68538399) is (6E,8Z,10E)-12H-triazino[1,2-a]diazonine.
What is the SMILES notation for (6E,8Z,10E)-12H-triazino[1,2-a]diazonine?
The canonical SMILES for (6E,8Z,10E)-12H-triazino[1,2-a]diazonine is C1=CN2/C=C/C=C\C=C\CN2N=C1.
What is the InChIKey of (6E,8Z,10E)-12H-triazino[1,2-a]diazonine?
The InChIKey is SOHJFPNWVLUIIC-BSIJAEHYSA-N. The full InChI is InChI=1S/C10H11N3/c1-2-4-8-12-9-6-7-11-13(12)10-5-3-1/h1-9H,10H2/b2-1-,5-3+,8-4+.
What are the key properties of (6E,8Z,10E)-12H-triazino[1,2-a]diazonine?
(6E,8Z,10E)-12H-triazino[1,2-a]diazonine has a molecular weight of 173.22 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6E,8Z,10E)-12H-triazino[1,2-a]diazonine is sourced from PubChem (CID 68538399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).