About 2H-cyclonona[d]triazine
2H-cyclonona[d]triazine (PubChem CID 68538400) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2H-cyclonona[d]triazine.
Molecular Properties
| Compound Name | 2H-cyclonona[d]triazine |
| PubChem CID | 68538400 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2H-cyclonona[d]triazine |
| SMILES | c1cccc2cn[nH]nc-2ccc1 |
| InChI | InChI=1S/C10H9N3/c1-2-4-6-9-8-11-13-12-10(9)7-5-3-1/h1-8,13H/b3-1-,4-2-,7-5-,9-6- |
| InChIKey | POLNTUJIQQSSCP-YAOXVPLHSA-N |
| XLogP | 2.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-cyclonona[d]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-cyclonona[d]triazine?
The IUPAC name of 2H-cyclonona[d]triazine (CID 68538400) is 2H-cyclonona[d]triazine.
What is the SMILES notation for 2H-cyclonona[d]triazine?
The canonical SMILES for 2H-cyclonona[d]triazine is c1cccc2cn[nH]nc-2ccc1.
What is the InChIKey of 2H-cyclonona[d]triazine?
The InChIKey is POLNTUJIQQSSCP-YAOXVPLHSA-N. The full InChI is InChI=1S/C10H9N3/c1-2-4-6-9-8-11-13-12-10(9)7-5-3-1/h1-8,13H/b3-1-,4-2-,7-5-,9-6-.
What are the key properties of 2H-cyclonona[d]triazine?
2H-cyclonona[d]triazine has a molecular weight of 171.20 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-cyclonona[d]triazine is sourced from PubChem (CID 68538400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).