C31H51N5O5 — CID 68538579
N-[(3S,6S,14R,16S)-16-[(1S,3R)-4-(butylamino)-1-hydroxy-3-methyl-4-oxobutyl]-3,14-dimethyl-2,5-dioxo-1,4-diazacyclohexadec-6-yl]pyridine-4-carboxamide (PubChem CID 68538579) has the molecular formula C31H51N5O5 and a molecular weight of 573.78 g/mol. Its IUPAC name is N-[(3S,6S,14R,16S)-16-[(1S,3R)-4-(butylamino)-1-hydroxy-3-methyl-4-oxobutyl]-3,14-dimethyl-2,5-dioxo-1,4-diazacyclohexadec-6-yl]pyridine-4-carboxamide.
| Compound Name | N-[(3S,6S,14R,16S)-16-[(1S,3R)-4-(butylamino)-1-hydroxy-3-methyl-4-oxobutyl]-3,14-dimethyl-2,5-dioxo-1,4-diazacyclohexadec-6-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 68538579 |
| Molecular Formula | C31H51N5O5 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.39 |
| IUPAC Name | N-[(3S,6S,14R,16S)-16-[(1S,3R)-4-(butylamino)-1-hydroxy-3-methyl-4-oxobutyl]-3,14-dimethyl-2,5-dioxo-1,4-diazacyclohexadec-6-yl]pyridine-4-carboxamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H]1C[C@H](C)CCCCCCC[C@H](NC(=O)c2ccncc2)C(=O)N[C@@H](C)C(=O)N1 |
| InChI | InChI=1S/C31H51N5O5/c1-5-6-16-33-28(38)22(3)20-27(37)26-19-21(2)12-10-8-7-9-11-13-25(31(41)34-23(4)29(39)36-26)35-30(40)24-14-17-32-18-15-24/h14-15,17-18,21-23,25-27,37H,5-13,16,19-20H2,1-4H3,(H,33,38)(H,34,41)(H,35,40)(H,36,39)/t21-,22-,23+,25+,26+,27+/m1/s1 |
| InChIKey | ODNVXZKBFVWGLK-AJFDNNOYSA-N |
| XLogP | 3.24 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|