About 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide
1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide (PubChem CID 68538605) has the molecular formula C17H24N4O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide.
Molecular Properties
| Compound Name | 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide |
| PubChem CID | 68538605 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide |
| SMILES | COc1ccc2cnn(CC3CN4CCC3CC4)c2c1.NC=O |
| InChI | InChI=1S/C16H21N3O.CH3NO/c1-20-15-3-2-13-9-17-19(16(13)8-15)11-14-10-18-6-4-12(14)5-7-18;2-1-3/h2-3,8-9,12,14H,4-7,10-11H2,1H3;1H,(H2,2,3) |
| InChIKey | XNEKZWCLWJFERT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide?
The IUPAC name of 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide (CID 68538605) is 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide.
What is the SMILES notation for 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide?
The canonical SMILES for 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide is COc1ccc2cnn(CC3CN4CCC3CC4)c2c1.NC=O.
What is the InChIKey of 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide?
The InChIKey is XNEKZWCLWJFERT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O.CH3NO/c1-20-15-3-2-13-9-17-19(16(13)8-15)11-14-10-18-6-4-12(14)5-7-18;2-1-3/h2-3,8-9,12,14H,4-7,10-11H2,1H3;1H,(H2,2,3).
What are the key properties of 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide?
1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide has a molecular weight of 316.40 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxyindazole;formamide is sourced from PubChem (CID 68538605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).