C27H38N2O4 — CID 68538649
[2,6-di(propan-2-yl)phenyl] 4-(N-[(2S)-2-aminopropanoyl]-4-hydroxyanilino)-3,3-dimethylbutanoate (PubChem CID 68538649) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 4-(N-[(2S)-2-aminopropanoyl]-4-hydroxyanilino)-3,3-dimethylbutanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 4-(N-[(2S)-2-aminopropanoyl]-4-hydroxyanilino)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 68538649 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 4-(N-[(2S)-2-aminopropanoyl]-4-hydroxyanilino)-3,3-dimethylbutanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)CC(C)(C)CN(C(=O)[C@H](C)N)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H38N2O4/c1-17(2)22-9-8-10-23(18(3)4)25(22)33-24(31)15-27(6,7)16-29(26(32)19(5)28)20-11-13-21(30)14-12-20/h8-14,17-19,30H,15-16,28H2,1-7H3/t19-/m0/s1 |
| InChIKey | UJZASSSYIHODCX-IBGZPJMESA-N |
| XLogP | 5.34 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|