C19H19N — CID 68538685
1-cyclopropyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline (PubChem CID 68538685) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-cyclopropyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline.
| Compound Name | 1-cyclopropyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
|---|---|
| PubChem CID | 68538685 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-cyclopropyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| SMILES | c1ccc2c(c1)CC1NCCc3ccc(C4CC4)c-2c31 |
| InChI | InChI=1S/C19H19N/c1-2-4-15-14(3-1)11-17-18-13(9-10-20-17)7-8-16(19(15)18)12-5-6-12/h1-4,7-8,12,17,20H,5-6,9-11H2 |
| InChIKey | LVLMEEXZRWPWEN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |