C27H42N4O7 — CID 68538720
N-(4-aminobutyl)-4-[4-[[5-propan-2-yl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]butanamide (PubChem CID 68538720) has the molecular formula C27H42N4O7 and a molecular weight of 534.65 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-[4-[[5-propan-2-yl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]butanamide.
| Compound Name | N-(4-aminobutyl)-4-[4-[[5-propan-2-yl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 68538720 |
| Molecular Formula | C27H42N4O7 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | N-(4-aminobutyl)-4-[4-[[5-propan-2-yl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]butanamide |
| SMILES | CC(C)c1[nH]nc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc1ccc(CCCC(=O)NCCCCN)cc1 |
| InChI | InChI=1S/C27H42N4O7/c1-16(2)22-19(26(31-30-22)38-27-25(36)24(35)23(34)20(15-32)37-27)14-18-10-8-17(9-11-18)6-5-7-21(33)29-13-4-3-12-28/h8-11,16,20,23-25,27,32,34-36H,3-7,12-15,28H2,1-2H3,(H,29,33)(H,30,31)/t20-,23-,24+,25-,27+/m1/s1 |
| InChIKey | AGYITIIBNIHOBQ-CVMXSPHISA-N |
| XLogP | 0.48 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|