C31H45N3O3 — CID 68538837
(9R,11S)-3-ethyl-11-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-9-methyl-3,12-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-2,13-dione (PubChem CID 68538837) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is (9R,11S)-3-ethyl-11-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-9-methyl-3,12-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-2,13-dione.
| Compound Name | (9R,11S)-3-ethyl-11-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-9-methyl-3,12-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-2,13-dione |
|---|---|
| PubChem CID | 68538837 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | (9R,11S)-3-ethyl-11-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-9-methyl-3,12-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-2,13-dione |
| SMILES | CCN1CCCCC[C@@H](C)C[C@@H]([C@H](O)CNCc2cccc(C(C)C)c2)NC(=O)c2cccc(c2)C1=O |
| InChI | InChI=1S/C31H45N3O3/c1-5-34-16-8-6-7-11-23(4)17-28(33-30(36)26-14-10-15-27(19-26)31(34)37)29(35)21-32-20-24-12-9-13-25(18-24)22(2)3/h9-10,12-15,18-19,22-23,28-29,32,35H,5-8,11,16-17,20-21H2,1-4H3,(H,33,36)/t23-,28+,29-/m1/s1 |
| InChIKey | MYMHIVTZLXPTIU-LDVROUIZSA-N |
| XLogP | 5.12 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |