C25H38N2O5S — CID 68538877
(4E,9S,10S,11R,14S)-10,14-dihydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-7-azacyclohexadec-4-ene-12,16-dione (PubChem CID 68538877) has the molecular formula C25H38N2O5S and a molecular weight of 478.66 g/mol. Its IUPAC name is (4E,9S,10S,11R,14S)-10,14-dihydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-7-azacyclohexadec-4-ene-12,16-dione.
| Compound Name | (4E,9S,10S,11R,14S)-10,14-dihydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-7-azacyclohexadec-4-ene-12,16-dione |
|---|---|
| PubChem CID | 68538877 |
| Molecular Formula | C25H38N2O5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (4E,9S,10S,11R,14S)-10,14-dihydroxy-9,11,13,13-tetramethyl-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxa-7-azacyclohexadec-4-ene-12,16-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1C/C=C/CNC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C25H38N2O5S/c1-15(11-19-14-33-18(4)27-19)20-9-7-8-10-26-13-16(2)23(30)17(3)24(31)25(5,6)21(28)12-22(29)32-20/h7-8,11,14,16-17,20-21,23,26,28,30H,9-10,12-13H2,1-6H3/b8-7+,15-11+/t16-,17+,20?,21-,23-/m0/s1 |
| InChIKey | DVKUKARCQVCYKT-AQLONGKOSA-N |
| XLogP | 3.30 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|