About (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine
(2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine (PubChem CID 68539128) has the molecular formula C17H18F2N2O3
and a molecular weight of 336.34 g/mol. Its IUPAC name is (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine.
Molecular Properties
| Compound Name | (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine |
| PubChem CID | 68539128 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine |
| SMILES | COc1cccc(C(Oc2c(F)cccc2F)[C@@H]2CNCCO2)n1 |
| InChI | InChI=1S/C17H18F2N2O3/c1-22-15-7-3-6-13(21-15)17(14-10-20-8-9-23-14)24-16-11(18)4-2-5-12(16)19/h2-7,14,17,20H,8-10H2,1H3/t14-,17?/m0/s1 |
| InChIKey | JRFJBBPBKSRVOX-MBIQTGHCSA-N |
| XLogP | 2.48 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine?
The IUPAC name of (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine (CID 68539128) is (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine.
What is the SMILES notation for (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine?
The canonical SMILES for (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine is COc1cccc(C(Oc2c(F)cccc2F)[C@@H]2CNCCO2)n1.
What is the InChIKey of (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine?
The InChIKey is JRFJBBPBKSRVOX-MBIQTGHCSA-N. The full InChI is InChI=1S/C17H18F2N2O3/c1-22-15-7-3-6-13(21-15)17(14-10-20-8-9-23-14)24-16-11(18)4-2-5-12(16)19/h2-7,14,17,20H,8-10H2,1H3/t14-,17?/m0/s1.
What are the key properties of (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine?
(2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine has a molecular weight of 336.34 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,6-difluorophenoxy)-(6-methoxy-2-pyridinyl)methyl]morpholine is sourced from PubChem (CID 68539128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).