C16H27NO — CID 68539267
7-ethyl-2-pentyl-3,4,4a,5-tetrahydro-1H-isoquinolin-6-ol (PubChem CID 68539267) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 7-ethyl-2-pentyl-3,4,4a,5-tetrahydro-1H-isoquinolin-6-ol.
| Compound Name | 7-ethyl-2-pentyl-3,4,4a,5-tetrahydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 68539267 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 7-ethyl-2-pentyl-3,4,4a,5-tetrahydro-1H-isoquinolin-6-ol |
| SMILES | CCCCCN1CCC2CC(O)=C(CC)C=C2C1 |
| InChI | InChI=1S/C16H27NO/c1-3-5-6-8-17-9-7-14-11-16(18)13(4-2)10-15(14)12-17/h10,14,18H,3-9,11-12H2,1-2H3 |
| InChIKey | DLTZXHWPIWFYLW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|