About 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol
2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol (PubChem CID 68539615) has the molecular formula C15H19FN4O
and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol.
Molecular Properties
| Compound Name | 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol |
| PubChem CID | 68539615 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol |
| SMILES | Oc1c(F)cccc1CN1CCN(C2=CCN=CN2)CC1 |
| InChI | InChI=1S/C15H19FN4O/c16-13-3-1-2-12(15(13)21)10-19-6-8-20(9-7-19)14-4-5-17-11-18-14/h1-4,11,21H,5-10H2,(H,17,18) |
| InChIKey | FIEGOKIJHAOZTQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol?
The IUPAC name of 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol (CID 68539615) is 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol.
What is the SMILES notation for 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol?
The canonical SMILES for 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol is Oc1c(F)cccc1CN1CCN(C2=CCN=CN2)CC1.
What is the InChIKey of 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol?
The InChIKey is FIEGOKIJHAOZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN4O/c16-13-3-1-2-12(15(13)21)10-19-6-8-20(9-7-19)14-4-5-17-11-18-14/h1-4,11,21H,5-10H2,(H,17,18).
What are the key properties of 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol?
2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol has a molecular weight of 290.34 g/mol, XLogP of 1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-6-fluorophenol is sourced from PubChem (CID 68539615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).