C25H29FO9 — CID 68539859
(E)-4-[[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-16,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 68539859) has the molecular formula C25H29FO9 and a molecular weight of 492.50 g/mol. Its IUPAC name is (E)-4-[[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-16,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-16,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68539859 |
| Molecular Formula | C25H29FO9 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (E)-4-[[(8S,9R,10S,11S,13S,14S,16R,17S)-9-fluoro-16,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3C[C@@H](O)[C@](O)(C(=O)CO)[C@@]3(C)C[C@H](OC(=O)/C=C/C(=O)O)[C@@]12F |
| InChI | InChI=1S/C25H29FO9/c1-22-8-7-14(28)9-13(22)3-4-15-16-10-17(29)25(34,18(30)12-27)23(16,2)11-19(24(15,22)26)35-21(33)6-5-20(31)32/h5-9,15-17,19,27,29,34H,3-4,10-12H2,1-2H3,(H,31,32)/b6-5+/t15-,16-,17+,19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | CVCSZHWDQKLLQQ-BAUAQZAOSA-N |
| XLogP | 0.81 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|