C44H29N5 — CID 68539924
3,5,7,8-tetraphenylporphyrin-2-amine (PubChem CID 68539924) has the molecular formula C44H29N5 and a molecular weight of 627.75 g/mol. Its IUPAC name is 3,5,7,8-tetraphenylporphyrin-2-amine.
| Compound Name | 3,5,7,8-tetraphenylporphyrin-2-amine |
|---|---|
| PubChem CID | 68539924 |
| Molecular Formula | C44H29N5 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 3,5,7,8-tetraphenylporphyrin-2-amine |
| SMILES | NC1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C44H29N5/c45-42-37-27-35-24-22-33(47-35)25-32-21-23-34(46-32)26-36-38(28-13-5-1-6-14-28)39(29-15-7-2-8-16-29)43(48-36)41(31-19-11-4-12-20-31)44(49-37)40(42)30-17-9-3-10-18-30/h1-27H,45H2/b32-25-,33-25-,34-26-,35-27-,36-26-,37-27-,43-41-,44-41- |
| InChIKey | REYPYYZNCFSGNT-UGNYBRDPSA-N |
| XLogP | 8.97 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|