C29H34FNO10 — CID 68540003
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[(3-fluoro-4-methylphenyl)methyl]-4,6-dimethyl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate (PubChem CID 68540003) has the molecular formula C29H34FNO10 and a molecular weight of 575.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[(3-fluoro-4-methylphenyl)methyl]-4,6-dimethyl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[(3-fluoro-4-methylphenyl)methyl]-4,6-dimethyl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68540003 |
| Molecular Formula | C29H34FNO10 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[(3-fluoro-4-methylphenyl)methyl]-4,6-dimethyl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2nc(C)cc(C)c2Cc2ccc(C)c(F)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H34FNO10/c1-14-8-9-21(12-23(14)30)11-22-15(2)10-16(3)31-28(22)41-29-27(39-20(7)35)26(38-19(6)34)25(37-18(5)33)24(40-29)13-36-17(4)32/h8-10,12,24-27,29H,11,13H2,1-7H3/t24-,25-,26+,27-,29+/m1/s1 |
| InChIKey | VKJFNIOOCCZXLS-QLZLUGFASA-N |
| XLogP | 3.20 |
| TPSA | 136.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|