C21H19N3O3S — CID 68540122
N-[5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-6-methylsulfanylquinolin-8-yl]acetamide (PubChem CID 68540122) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-6-methylsulfanylquinolin-8-yl]acetamide.
| Compound Name | N-[5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-6-methylsulfanylquinolin-8-yl]acetamide |
|---|---|
| PubChem CID | 68540122 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[5-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-6-methylsulfanylquinolin-8-yl]acetamide |
| SMILES | CSc1cc(NC(C)=O)c2ncccc2c1N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C21H19N3O3S/c1-10(25)23-14-9-15(28-2)19(13-4-3-7-22-18(13)14)24-20(26)16-11-5-6-12(8-11)17(16)21(24)27/h3-7,9,11-12,16-17H,8H2,1-2H3,(H,23,25) |
| InChIKey | YEVGZHDHDJEQQN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|