C9H10N2 — CID 68540132
7-methylidenebicyclo[4.2.0]octa-1,3,5-triene-2,5-diamine (PubChem CID 68540132) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 7-methylidenebicyclo[4.2.0]octa-1,3,5-triene-2,5-diamine.
| Compound Name | 7-methylidenebicyclo[4.2.0]octa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 68540132 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 7-methylidenebicyclo[4.2.0]octa-1,3,5-triene-2,5-diamine |
| SMILES | C=C1Cc2c(N)ccc(N)c21 |
| InChI | InChI=1S/C9H10N2/c1-5-4-6-7(10)2-3-8(11)9(5)6/h2-3H,1,4,10-11H2 |
| InChIKey | JVESKMJTTVZPCS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|