About 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid
4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid (PubChem CID 68540290) has the molecular formula C15H27N3O4
and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid |
| PubChem CID | 68540290 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid |
| SMILES | CC1C(=O)N(CCCN2CC[C@H](C)[C@H](O)C2)CCN1C(=O)O |
| InChI | InChI=1S/C15H27N3O4/c1-11-4-7-16(10-13(11)19)5-3-6-17-8-9-18(15(21)22)12(2)14(17)20/h11-13,19H,3-10H2,1-2H3,(H,21,22)/t11-,12?,13+/m0/s1 |
| InChIKey | XHTHWGTWWLSLHU-IAMFDIQRSA-N |
| XLogP | 0.29 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid?
The IUPAC name of 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid (CID 68540290) is 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid.
What is the SMILES notation for 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid?
The canonical SMILES for 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid is CC1C(=O)N(CCCN2CC[C@H](C)[C@H](O)C2)CCN1C(=O)O.
What is the InChIKey of 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid?
The InChIKey is XHTHWGTWWLSLHU-IAMFDIQRSA-N. The full InChI is InChI=1S/C15H27N3O4/c1-11-4-7-16(10-13(11)19)5-3-6-17-8-9-18(15(21)22)12(2)14(17)20/h11-13,19H,3-10H2,1-2H3,(H,21,22)/t11-,12?,13+/m0/s1.
What are the key properties of 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid?
4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid has a molecular weight of 313.40 g/mol, XLogP of 0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3S,4S)-3-hydroxy-4-methylpiperidin-1-yl]propyl]-2-methyl-3-oxopiperazine-1-carboxylic acid is sourced from PubChem (CID 68540290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).