C21H21NO6S2 — CID 68540336
3-(carboxymethoxy)-10-(cyclohexylmethylcarbamoyl)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid (PubChem CID 68540336) has the molecular formula C21H21NO6S2 and a molecular weight of 447.53 g/mol. Its IUPAC name is 3-(carboxymethoxy)-10-(cyclohexylmethylcarbamoyl)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-10-(cyclohexylmethylcarbamoyl)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid |
|---|---|
| PubChem CID | 68540336 |
| Molecular Formula | C21H21NO6S2 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3-(carboxymethoxy)-10-(cyclohexylmethylcarbamoyl)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid |
| SMILES | O=C(O)COc1c(C(=O)O)sc2cc3cc(C(=O)NCC4CCCCC4)csc-3c12 |
| InChI | InChI=1S/C21H21NO6S2/c23-15(24)9-28-17-16-14(30-19(17)21(26)27)7-12-6-13(10-29-18(12)16)20(25)22-8-11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2,(H,22,25)(H,23,24)(H,26,27) |
| InChIKey | QKUXURQRMORRIO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |