C24H27NO6S2 — CID 68540410
methyl 10-(cyclohexylmethylcarbamoyl)-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate (PubChem CID 68540410) has the molecular formula C24H27NO6S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is methyl 10-(cyclohexylmethylcarbamoyl)-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate.
| Compound Name | methyl 10-(cyclohexylmethylcarbamoyl)-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 68540410 |
| Molecular Formula | C24H27NO6S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | methyl 10-(cyclohexylmethylcarbamoyl)-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate |
| SMILES | CCOC(=O)COc1c(C(=O)OC)sc2cc3cc(C(=O)NCC4CCCCC4)csc-3c12 |
| InChI | InChI=1S/C24H27NO6S2/c1-3-30-18(26)12-31-20-19-17(33-22(20)24(28)29-2)10-15-9-16(13-32-21(15)19)23(27)25-11-14-7-5-4-6-8-14/h9-10,13-14H,3-8,11-12H2,1-2H3,(H,25,27) |
| InChIKey | FCZHVVRIROLLEU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |