C24H27NO7S2 — CID 68540414
methyl 11-[cyclohexyl(methoxycarbonyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate (PubChem CID 68540414) has the molecular formula C24H27NO7S2 and a molecular weight of 505.61 g/mol. Its IUPAC name is methyl 11-[cyclohexyl(methoxycarbonyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate.
| Compound Name | methyl 11-[cyclohexyl(methoxycarbonyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 68540414 |
| Molecular Formula | C24H27NO7S2 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | methyl 11-[cyclohexyl(methoxycarbonyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate |
| SMILES | CCOC(=O)COc1c(C(=O)OC)sc2cc3ccc(N(C(=O)OC)C4CCCCC4)sc-3c12 |
| InChI | InChI=1S/C24H27NO7S2/c1-4-31-18(26)13-32-20-19-16(33-22(20)23(27)29-2)12-14-10-11-17(34-21(14)19)25(24(28)30-3)15-8-6-5-7-9-15/h10-12,15H,4-9,13H2,1-3H3 |
| InChIKey | AEIZETVWSOLVFD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|