C24H31F2N3O4S — CID 68540574
N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[6-(2-methylpropyl)-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl]amino]butan-2-yl]acetamide (PubChem CID 68540574) has the molecular formula C24H31F2N3O4S and a molecular weight of 495.59 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[6-(2-methylpropyl)-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[6-(2-methylpropyl)-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68540574 |
| Molecular Formula | C24H31F2N3O4S |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[6-(2-methylpropyl)-2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(Cc1cc(F)cc(F)c1)C(O)CNC1CS(=O)(=O)Nc2ccc(CC(C)C)cc21 |
| InChI | InChI=1S/C24H31F2N3O4S/c1-14(2)6-16-4-5-21-20(9-16)23(13-34(32,33)29-21)27-12-24(31)22(28-15(3)30)10-17-7-18(25)11-19(26)8-17/h4-5,7-9,11,14,22-24,27,29,31H,6,10,12-13H2,1-3H3,(H,28,30) |
| InChIKey | KZFDRYFNZRRUMA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |