C28H36N2O7S2 — CID 68540741
tert-butyl 4-[[4-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaen-10-yl]amino]piperidine-1-carboxylate (PubChem CID 68540741) has the molecular formula C28H36N2O7S2 and a molecular weight of 576.74 g/mol. Its IUPAC name is tert-butyl 4-[[4-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaen-10-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaen-10-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68540741 |
| Molecular Formula | C28H36N2O7S2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | tert-butyl 4-[[4-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaen-10-yl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)c1sc2cc3cc(NC4CCN(C(=O)OC(C)(C)C)CC4)csc-3c2c1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H36N2O7S2/c1-27(2,3)36-20(31)14-35-22-21-19(39-24(22)25(32)34-7)13-16-12-18(15-38-23(16)21)29-17-8-10-30(11-9-17)26(33)37-28(4,5)6/h12-13,15,17,29H,8-11,14H2,1-7H3 |
| InChIKey | GXYUXZZZIVATQV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|