C12H8N6 — CID 68540845
3,4,5,6,8,9-hexazatricyclo[8.8.0.02,7]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene (PubChem CID 68540845) has the molecular formula C12H8N6 and a molecular weight of 236.24 g/mol. Its IUPAC name is 3,4,5,6,8,9-hexazatricyclo[8.8.0.02,7]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene.
| Compound Name | 3,4,5,6,8,9-hexazatricyclo[8.8.0.02,7]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 68540845 |
| Molecular Formula | C12H8N6 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3,4,5,6,8,9-hexazatricyclo[8.8.0.02,7]octadeca-1(18),2(7),3,5,8,10,12,14,16-nonaene |
| SMILES | c1ccccc2c(ccc1)nnc1nnnnc12 |
| InChI | InChI=1S/C12H8N6/c1-2-4-6-8-10-9(7-5-3-1)11-12(15-13-10)16-18-17-14-11/h1-8H/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,9-7+,10-8+ |
| InChIKey | NFTJFUONHRCBKN-SPCXORDVSA-N |
| XLogP | 1.49 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |