C20H17F3N2O4S — CID 68540919
(3aR,4R,5S,7R,7aS)-5-hydroxy-4,7-dimethyl-2-[4-(1,3-thiazol-2-yl)-3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 68540919) has the molecular formula C20H17F3N2O4S and a molecular weight of 438.43 g/mol. Its IUPAC name is (3aR,4R,5S,7R,7aS)-5-hydroxy-4,7-dimethyl-2-[4-(1,3-thiazol-2-yl)-3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,5S,7R,7aS)-5-hydroxy-4,7-dimethyl-2-[4-(1,3-thiazol-2-yl)-3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 68540919 |
| Molecular Formula | C20H17F3N2O4S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (3aR,4R,5S,7R,7aS)-5-hydroxy-4,7-dimethyl-2-[4-(1,3-thiazol-2-yl)-3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12O[C@](C)(C[C@@H]1O)[C@H]1C(=O)N(c3ccc(-c4nccs4)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H17F3N2O4S/c1-18-8-12(26)19(2,29-18)14-13(18)16(27)25(17(14)28)9-3-4-10(15-24-5-6-30-15)11(7-9)20(21,22)23/h3-7,12-14,26H,8H2,1-2H3/t12-,13+,14-,18+,19-/m0/s1 |
| InChIKey | MEKRWXSKYYSWLB-SCCROHOISA-N |
| XLogP | 3.25 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|