C7H11NO6S — CID 68540976
[6-[(R)-methylsulfinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 68540976) has the molecular formula C7H11NO6S and a molecular weight of 237.23 g/mol. Its IUPAC name is [6-[(R)-methylsulfinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [6-[(R)-methylsulfinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 68540976 |
| Molecular Formula | C7H11NO6S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | [6-[(R)-methylsulfinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | C[S@@](=O)C1COC2C(O[N+](=O)[O-])COC21 |
| InChI | InChI=1S/C7H11NO6S/c1-15(11)5-3-13-6-4(14-8(9)10)2-12-7(5)6/h4-7H,2-3H2,1H3/t4?,5?,6?,7?,15-/m1/s1 |
| InChIKey | RCKIQKHUYOYQAG-MGSQLTTASA-N |
| XLogP | -0.89 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|