C29H22ClN3O5 — CID 68541066
4-[(3aS,4S,7S,7aR)-4-[2-[(6-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 68541066) has the molecular formula C29H22ClN3O5 and a molecular weight of 527.96 g/mol. Its IUPAC name is 4-[(3aS,4S,7S,7aR)-4-[2-[(6-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aS,4S,7S,7aR)-4-[2-[(6-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 68541066 |
| Molecular Formula | C29H22ClN3O5 |
| Molecular Weight | 527.96 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 4-[(3aS,4S,7S,7aR)-4-[2-[(6-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | C[C@@]12CC[C@@](CCOc3noc4cc(Cl)ccc34)(O1)[C@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H22ClN3O5/c1-28-10-11-29(38-28,12-13-36-25-20-8-7-17(30)14-22(20)37-32-25)24-23(28)26(34)33(27(24)35)21-9-6-16(15-31)18-4-2-3-5-19(18)21/h2-9,14,23-24H,10-13H2,1H3/t23-,24+,28-,29-/m0/s1 |
| InChIKey | FMXHMCGHZBMJKE-YZUKIZEGSA-N |
| XLogP | 5.40 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.96 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|