About 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid
2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid (PubChem CID 68541550) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid.
Molecular Properties
| Compound Name | 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid |
| PubChem CID | 68541550 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid |
| SMILES | CC(C)/N=C(\C(=O)O)N(C)C1=CC=CC1 |
| InChI | InChI=1S/C11H16N2O2/c1-8(2)12-10(11(14)15)13(3)9-6-4-5-7-9/h4-6,8H,7H2,1-3H3,(H,14,15)/b12-10+ |
| InChIKey | MSKSTVJMQATIBK-ZRDIBKRKSA-N |
| XLogP | 1.65 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid?
The IUPAC name of 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid (CID 68541550) is 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid.
What is the SMILES notation for 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid?
The canonical SMILES for 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid is CC(C)/N=C(\C(=O)O)N(C)C1=CC=CC1.
What is the InChIKey of 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid?
The InChIKey is MSKSTVJMQATIBK-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8(2)12-10(11(14)15)13(3)9-6-4-5-7-9/h4-6,8H,7H2,1-3H3,(H,14,15)/b12-10+.
What are the key properties of 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid?
2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid has a molecular weight of 208.26 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopenta-1,3-dien-1-yl(methyl)amino]-2-propan-2-yliminoacetic acid is sourced from PubChem (CID 68541550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).