C19H21NO7S — CID 68541989
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1H-indol-6-yloxy)thian-3-yl] acetate (PubChem CID 68541989) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1H-indol-6-yloxy)thian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1H-indol-6-yloxy)thian-3-yl] acetate |
|---|---|
| PubChem CID | 68541989 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1H-indol-6-yloxy)thian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CS[C@H]1Oc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C19H21NO7S/c1-10(21)24-16-9-28-19(18(26-12(3)23)17(16)25-11(2)22)27-14-5-4-13-6-7-20-15(13)8-14/h4-8,16-20H,9H2,1-3H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | NTVJEACRMRLICU-FCGDIQPGSA-N |
| XLogP | 2.41 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|