C16H9NO3 — CID 685423
12-acetyl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 685423) has the molecular formula C16H9NO3 and a molecular weight of 263.25 g/mol. Its IUPAC name is 12-acetyl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-acetyl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 685423 |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 12-acetyl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CC(=O)c1ccc2c3c(onc13)-c1ccccc1C2=O |
| InChI | InChI=1S/C16H9NO3/c1-8(18)9-6-7-12-13-14(9)17-20-16(13)11-5-3-2-4-10(11)15(12)19/h2-7H,1H3 |
| InChIKey | UICMTKUSESHZNZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|