About spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one
spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one (PubChem CID 685425) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one.
Molecular Properties
| Compound Name | spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one |
| PubChem CID | 685425 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one |
| SMILES | O=C1NC2(CCCCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C15H19NO/c17-14-13-8-4-3-7-12(13)11-15(16-14)9-5-1-2-6-10-15/h3-4,7-8H,1-2,5-6,9-11H2,(H,16,17) |
| InChIKey | PHFZTRWMBRIDCU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one?
The IUPAC name of spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one (CID 685425) is spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one.
What is the SMILES notation for spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one?
The canonical SMILES for spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one is O=C1NC2(CCCCCC2)Cc2ccccc21.
What is the InChIKey of spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one?
The InChIKey is PHFZTRWMBRIDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c17-14-13-8-4-3-7-12(13)11-15(16-14)9-5-1-2-6-10-15/h3-4,7-8H,1-2,5-6,9-11H2,(H,16,17).
What are the key properties of spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one?
spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one has a molecular weight of 229.32 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,4-dihydroisoquinoline-3,1'-cycloheptane]-1-one is sourced from PubChem (CID 685425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).