C29H29NO6S2 — CID 68542553
methyl 10-[benzoyl(cyclohexyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate (PubChem CID 68542553) has the molecular formula C29H29NO6S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is methyl 10-[benzoyl(cyclohexyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate.
| Compound Name | methyl 10-[benzoyl(cyclohexyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 68542553 |
| Molecular Formula | C29H29NO6S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | methyl 10-[benzoyl(cyclohexyl)amino]-3-(2-ethoxy-2-oxoethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylate |
| SMILES | CCOC(=O)COc1c(C(=O)OC)sc2cc3cc(N(C(=O)c4ccccc4)C4CCCCC4)csc-3c12 |
| InChI | InChI=1S/C29H29NO6S2/c1-3-35-23(31)16-36-25-24-22(38-27(25)29(33)34-2)15-19-14-21(17-37-26(19)24)30(20-12-8-5-9-13-20)28(32)18-10-6-4-7-11-18/h4,6-7,10-11,14-15,17,20H,3,5,8-9,12-13,16H2,1-2H3 |
| InChIKey | PMPMCUHKYCYJSZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |