C23H26N2O6S2 — CID 68542587
3-(carboxymethoxy)-11-[cyclohexylmethyl(ethylcarbamoyl)amino]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid (PubChem CID 68542587) has the molecular formula C23H26N2O6S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 3-(carboxymethoxy)-11-[cyclohexylmethyl(ethylcarbamoyl)amino]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-11-[cyclohexylmethyl(ethylcarbamoyl)amino]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid |
|---|---|
| PubChem CID | 68542587 |
| Molecular Formula | C23H26N2O6S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-(carboxymethoxy)-11-[cyclohexylmethyl(ethylcarbamoyl)amino]-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid |
| SMILES | CCNC(=O)N(CC1CCCCC1)c1ccc2cc3sc(C(=O)O)c(OCC(=O)O)c3c-2s1 |
| InChI | InChI=1S/C23H26N2O6S2/c1-2-24-23(30)25(11-13-6-4-3-5-7-13)16-9-8-14-10-15-18(20(14)33-16)19(31-12-17(26)27)21(32-15)22(28)29/h8-10,13H,2-7,11-12H2,1H3,(H,24,30)(H,26,27)(H,28,29) |
| InChIKey | HTJFQOHOEYRTCE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |