C25H22ClNO3S — CID 68542746
4-[2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-enoyl]benzoic acid (PubChem CID 68542746) has the molecular formula C25H22ClNO3S and a molecular weight of 451.98 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 68542746 |
| Molecular Formula | C25H22ClNO3S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-enoyl]benzoic acid |
| SMILES | CN(C)c1ccc(C=C(SCc2ccc(Cl)cc2)C(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H22ClNO3S/c1-27(2)22-13-5-17(6-14-22)15-23(31-16-18-3-11-21(26)12-4-18)24(28)19-7-9-20(10-8-19)25(29)30/h3-15H,16H2,1-2H3,(H,29,30) |
| InChIKey | ULXUWXDHCGETIO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|