C22H23NO6S2 — CID 68542998
11-[acetyl(cyclohexylmethyl)amino]-3-(carboxymethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid (PubChem CID 68542998) has the molecular formula C22H23NO6S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is 11-[acetyl(cyclohexylmethyl)amino]-3-(carboxymethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid.
| Compound Name | 11-[acetyl(cyclohexylmethyl)amino]-3-(carboxymethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid |
|---|---|
| PubChem CID | 68542998 |
| Molecular Formula | C22H23NO6S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 11-[acetyl(cyclohexylmethyl)amino]-3-(carboxymethoxy)-5,12-dithiatricyclo[6.4.0.02,6]dodeca-1,3,6,8,10-pentaene-4-carboxylic acid |
| SMILES | CC(=O)N(CC1CCCCC1)c1ccc2cc3sc(C(=O)O)c(OCC(=O)O)c3c-2s1 |
| InChI | InChI=1S/C22H23NO6S2/c1-12(24)23(10-13-5-3-2-4-6-13)16-8-7-14-9-15-18(20(14)31-16)19(29-11-17(25)26)21(30-15)22(27)28/h7-9,13H,2-6,10-11H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | RHLZGPZJJPPEAP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |