C18H19NO4S — CID 68543104
(2R,6S)-4-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 68543104) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2R,6S)-4-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | (2R,6S)-4-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 68543104 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2R,6S)-4-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | O=C1[C@@H]2C3CCC(CC3)[C@@H]2C(=O)N1c1ccc2c(c1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C18H19NO4S/c20-17-15-10-1-2-11(4-3-10)16(15)18(21)19(17)14-6-5-12-8-24(22,23)9-13(12)7-14/h5-7,10-11,15-16H,1-4,8-9H2/t10?,11?,15-,16+ |
| InChIKey | NWEXGINXCRZUNN-YOZJYKESSA-N |
| XLogP | 2.04 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|