C21H19BrN2O5 — CID 68544094
(3aR,4R,7R,7aS)-4-(2-bromoethyl)-7-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 68544094) has the molecular formula C21H19BrN2O5 and a molecular weight of 459.30 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-4-(2-bromoethyl)-7-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-4-(2-bromoethyl)-7-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 68544094 |
| Molecular Formula | C21H19BrN2O5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | (3aR,4R,7R,7aS)-4-(2-bromoethyl)-7-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12CC[C@](CCBr)(O1)[C@@H]1C(=O)N(c3ccc([N+](=O)[O-])c4ccccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H19BrN2O5/c1-20-8-9-21(29-20,10-11-22)17-16(20)18(25)23(19(17)26)14-6-7-15(24(27)28)13-5-3-2-4-12(13)14/h2-7,16-17H,8-11H2,1H3/t16-,17+,20-,21-/m1/s1 |
| InChIKey | UMABBGYJMPIDOR-HRQSHJORSA-N |
| XLogP | 3.96 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|