C22H25NO3 — CID 68544553
ethyl (E)-3-[3-hydroxy-2-(3-methylbut-2-enyl)anilino]-3-phenylprop-2-enoate (PubChem CID 68544553) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl (E)-3-[3-hydroxy-2-(3-methylbut-2-enyl)anilino]-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-3-[3-hydroxy-2-(3-methylbut-2-enyl)anilino]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 68544553 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl (E)-3-[3-hydroxy-2-(3-methylbut-2-enyl)anilino]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C=C(/Nc1cccc(O)c1CC=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-4-26-22(25)15-20(17-9-6-5-7-10-17)23-19-11-8-12-21(24)18(19)14-13-16(2)3/h5-13,15,23-24H,4,14H2,1-3H3/b20-15+ |
| InChIKey | MLIHWPBAAGGRFL-HMMYKYKNSA-N |
| XLogP | 4.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|