C17H13BrF3NO2 — CID 68545055
(1R,2S,6R,7R)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 68545055) has the molecular formula C17H13BrF3NO2 and a molecular weight of 400.19 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 68545055 |
| Molecular Formula | C17H13BrF3NO2 |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (1R,2S,6R,7R)-4-[4-bromo-3-(trifluoromethyl)phenyl]-8-methyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C[C@H]2C[C@@H]1[C@H]1C(=O)N(c3ccc(Br)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H13BrF3NO2/c1-7-4-8-5-10(7)14-13(8)15(23)22(16(14)24)9-2-3-12(18)11(6-9)17(19,20)21/h2-4,6,8,10,13-14H,5H2,1H3/t8-,10-,13-,14+/m0/s1 |
| InChIKey | OTHKTLYQZKFZQM-UVJIQFMESA-N |
| XLogP | 4.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|