C18H19NO3 — CID 68545109
4-(3-ethylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 68545109) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-(3-ethylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | 4-(3-ethylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 68545109 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-(3-ethylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | CCc1cccc(N2C(=O)C3C4CCC(C(=O)C4)C3C2=O)c1 |
| InChI | InChI=1S/C18H19NO3/c1-2-10-4-3-5-12(8-10)19-17(21)15-11-6-7-13(14(20)9-11)16(15)18(19)22/h3-5,8,11,13,15-16H,2,6-7,9H2,1H3 |
| InChIKey | HKDZTMSXEVXFEX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|